C14H14N2O3 — CID 130276401
N,N-dimethyl-2-(4-nitronaphthalen-1-yl)acetamide (PubChem CID 130276401) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-nitronaphthalen-1-yl)acetamide.
| Compound Name | N,N-dimethyl-2-(4-nitronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 130276401 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N,N-dimethyl-2-(4-nitronaphthalen-1-yl)acetamide |
| SMILES | CN(C)C(=O)Cc1ccc([N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C14H14N2O3/c1-15(2)14(17)9-10-7-8-13(16(18)19)12-6-4-3-5-11(10)12/h3-8H,9H2,1-2H3 |
| InChIKey | BNCCTSQIQWVAHD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|