C17H19N3O3 — CID 71981770
N,N-dimethyl-2-[2-[(2-nitrophenyl)methylamino]phenyl]acetamide (PubChem CID 71981770) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-[(2-nitrophenyl)methylamino]phenyl]acetamide.
| Compound Name | N,N-dimethyl-2-[2-[(2-nitrophenyl)methylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 71981770 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N,N-dimethyl-2-[2-[(2-nitrophenyl)methylamino]phenyl]acetamide |
| SMILES | CN(C)C(=O)Cc1ccccc1NCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19N3O3/c1-19(2)17(21)11-13-7-3-5-9-15(13)18-12-14-8-4-6-10-16(14)20(22)23/h3-10,18H,11-12H2,1-2H3 |
| InChIKey | KROPQNZQMKJHAF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|