C14H8KO5S- — CID 174411913
potassium;(9,10-dioxoanthracen-1-yl) sulfite;hydride (PubChem CID 174411913) has the molecular formula C14H8KO5S- and a molecular weight of 327.38 g/mol. Its IUPAC name is potassium;(9,10-dioxoanthracen-1-yl) sulfite;hydride.
| Compound Name | potassium;(9,10-dioxoanthracen-1-yl) sulfite;hydride |
|---|---|
| PubChem CID | 174411913 |
| Molecular Formula | C14H8KO5S- |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | potassium;(9,10-dioxoanthracen-1-yl) sulfite;hydride |
| SMILES | O=C1c2ccccc2C(=O)c2c(OS(=O)[O-])cccc21.[H-].[K+] |
| InChI | InChI=1S/C14H8O5S.K.H/c15-13-8-4-1-2-5-9(8)14(16)12-10(13)6-3-7-11(12)19-20(17)18;;/h1-7H,(H,17,18);;/q;+1;-1/p-1 |
| InChIKey | XEXATHPXQOZCGP-UHFFFAOYSA-M |
| XLogP | -1.25 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|