C28H20Na2O6S2 — CID 58517350
disodium;[2-[(E)-2-[4-[4-[(E)-2-(2-sulfinatooxyphenyl)ethenyl]phenyl]phenyl]ethenyl]phenyl] sulfite (PubChem CID 58517350) has the molecular formula C28H20Na2O6S2 and a molecular weight of 562.58 g/mol. Its IUPAC name is disodium;[2-[(E)-2-[4-[4-[(E)-2-(2-sulfinatooxyphenyl)ethenyl]phenyl]phenyl]ethenyl]phenyl] sulfite.
| Compound Name | disodium;[2-[(E)-2-[4-[4-[(E)-2-(2-sulfinatooxyphenyl)ethenyl]phenyl]phenyl]ethenyl]phenyl] sulfite |
|---|---|
| PubChem CID | 58517350 |
| Molecular Formula | C28H20Na2O6S2 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.05 |
| IUPAC Name | disodium;[2-[(E)-2-[4-[4-[(E)-2-(2-sulfinatooxyphenyl)ethenyl]phenyl]phenyl]ethenyl]phenyl] sulfite |
| SMILES | O=S([O-])Oc1ccccc1/C=C/c1ccc(-c2ccc(/C=C/c3ccccc3OS(=O)[O-])cc2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C28H22O6S2.2Na/c29-35(30)33-27-7-3-1-5-25(27)19-13-21-9-15-23(16-10-21)24-17-11-22(12-18-24)14-20-26-6-2-4-8-28(26)34-36(31)32;;/h1-20H,(H,29,30)(H,31,32);;/q;2*+1/p-2/b19-13+,20-14+;; |
| InChIKey | WAIYCSRFZVLZNQ-HPKCLRQXSA-L |
| XLogP | 0.05 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|