C22H15NO4 — CID 70586755
[2-[2-[4-(1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl] hydrogen carbonate (PubChem CID 70586755) has the molecular formula C22H15NO4 and a molecular weight of 357.37 g/mol. Its IUPAC name is [2-[2-[4-(1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl] hydrogen carbonate.
| Compound Name | [2-[2-[4-(1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 70586755 |
| Molecular Formula | C22H15NO4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | [2-[2-[4-(1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccccc1C=Cc1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C22H15NO4/c24-22(25)27-19-7-3-1-5-16(19)12-9-15-10-13-17(14-11-15)21-23-18-6-2-4-8-20(18)26-21/h1-14H,(H,24,25) |
| InChIKey | SYNXQYZEGFDQRT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|