C28H20N2O2 — CID 165125338
2-[4-[(E)-2-[4-(5,6-dihydro-1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole (PubChem CID 165125338) has the molecular formula C28H20N2O2 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-(5,6-dihydro-1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-[(E)-2-[4-(5,6-dihydro-1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 165125338 |
| Molecular Formula | C28H20N2O2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-[4-[(E)-2-[4-(5,6-dihydro-1,3-benzoxazol-2-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole |
| SMILES | C1=c2nc(-c3ccc(/C=C/c4ccc(-c5nc6ccccc6o5)cc4)cc3)oc2=CCC1 |
| InChI | InChI=1S/C28H20N2O2/c1-3-7-25-23(5-1)29-27(31-25)21-15-11-19(12-16-21)9-10-20-13-17-22(18-14-20)28-30-24-6-2-4-8-26(24)32-28/h1,3,5-18H,2,4H2/b10-9+ |
| InChIKey | AGRBVUNATZFOJZ-MDZDMXLPSA-N |
| XLogP | 5.68 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|