C31H34N2O5 — CID 102380777
2-[4-[(E)-2-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole (PubChem CID 102380777) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-[(E)-2-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 102380777 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 2-[4-[(E)-2-[4-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)phenyl]ethenyl]phenyl]-1,3-benzoxazole |
| SMILES | C(=C/c1ccc(N2CCOCCOCCOCCOCC2)cc1)\c1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C31H34N2O5/c1-2-4-30-29(3-1)32-31(38-30)27-11-7-25(8-12-27)5-6-26-9-13-28(14-10-26)33-15-17-34-19-21-36-23-24-37-22-20-35-18-16-33/h1-14H,15-24H2/b6-5+ |
| InChIKey | SGZFIBXIDFNCID-AATRIKPKSA-N |
| XLogP | 5.55 |
| TPSA | 66.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|