C28H18N2O8S2 — CID 157169382
5-(1,3-benzoxazol-2-yl)-2-[2-[4-(1,3-benzoxazol-2-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 157169382) has the molecular formula C28H18N2O8S2 and a molecular weight of 574.59 g/mol. Its IUPAC name is 5-(1,3-benzoxazol-2-yl)-2-[2-[4-(1,3-benzoxazol-2-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-(1,3-benzoxazol-2-yl)-2-[2-[4-(1,3-benzoxazol-2-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 157169382 |
| Molecular Formula | C28H18N2O8S2 |
| Molecular Weight | 574.59 g/mol |
| Exact Mass | 574.05 |
| IUPAC Name | 5-(1,3-benzoxazol-2-yl)-2-[2-[4-(1,3-benzoxazol-2-yl)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(-c2nc3ccccc3o2)ccc1C=Cc1ccc(-c2nc3ccccc3o2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C28H18N2O8S2/c31-39(32,33)25-15-19(27-29-21-5-1-3-7-23(21)37-27)13-11-17(25)9-10-18-12-14-20(16-26(18)40(34,35)36)28-30-22-6-2-4-8-24(22)38-28/h1-16H,(H,31,32,33)(H,34,35,36) |
| InChIKey | CDBMSNYICDPCHQ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.59 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|