C14H7Cl2NO2 — CID 20556598
4-(1,3-benzoxazol-2-yl)-2-chlorobenzoyl chloride (PubChem CID 20556598) has the molecular formula C14H7Cl2NO2 and a molecular weight of 292.12 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-2-chlorobenzoyl chloride.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-2-chlorobenzoyl chloride |
|---|---|
| PubChem CID | 20556598 |
| Molecular Formula | C14H7Cl2NO2 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-2-chlorobenzoyl chloride |
| SMILES | O=C(Cl)c1ccc(-c2nc3ccccc3o2)cc1Cl |
| InChI | InChI=1S/C14H7Cl2NO2/c15-10-7-8(5-6-9(10)13(16)18)14-17-11-3-1-2-4-12(11)19-14/h1-7H |
| InChIKey | RCNRUBNQUNPIHK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|