C14H8ClNO4 — CID 136740250
4-(1,3-benzoxazol-2-yl)-2,5-dihydroxybenzoyl chloride (PubChem CID 136740250) has the molecular formula C14H8ClNO4 and a molecular weight of 289.67 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-2,5-dihydroxybenzoyl chloride.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-2,5-dihydroxybenzoyl chloride |
|---|---|
| PubChem CID | 136740250 |
| Molecular Formula | C14H8ClNO4 |
| Molecular Weight | 289.67 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-2,5-dihydroxybenzoyl chloride |
| SMILES | O=C(Cl)c1cc(O)c(-c2nc3ccccc3o2)cc1O |
| InChI | InChI=1S/C14H8ClNO4/c15-13(19)7-5-11(18)8(6-10(7)17)14-16-9-3-1-2-4-12(9)20-14/h1-6,17-18H |
| InChIKey | IDIVMUHORJLANN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.67 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|