C28H22N2O3 — CID 175306956
4-aminobenzoic acid;2-[2-(2-phenylethenyl)phenyl]-1,3-benzoxazole (PubChem CID 175306956) has the molecular formula C28H22N2O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 4-aminobenzoic acid;2-[2-(2-phenylethenyl)phenyl]-1,3-benzoxazole.
| Compound Name | 4-aminobenzoic acid;2-[2-(2-phenylethenyl)phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 175306956 |
| Molecular Formula | C28H22N2O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 4-aminobenzoic acid;2-[2-(2-phenylethenyl)phenyl]-1,3-benzoxazole |
| SMILES | C(=Cc1ccccc1-c1nc2ccccc2o1)c1ccccc1.Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H15NO.C7H7NO2/c1-2-8-16(9-3-1)14-15-17-10-4-5-11-18(17)21-22-19-12-6-7-13-20(19)23-21;8-6-3-1-5(2-4-6)7(9)10/h1-15H;1-4H,8H2,(H,9,10) |
| InChIKey | MSSFXFZRXNKCSB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|