C23H22N3O+ — CID 12597871
4-[(E)-2-[3-(1,3-benzoxazol-2-yl)-1-methylpyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 12597871) has the molecular formula C23H22N3O+ and a molecular weight of 356.45 g/mol. Its IUPAC name is 4-[(E)-2-[3-(1,3-benzoxazol-2-yl)-1-methylpyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[3-(1,3-benzoxazol-2-yl)-1-methylpyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 12597871 |
| Molecular Formula | C23H22N3O+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 4-[(E)-2-[3-(1,3-benzoxazol-2-yl)-1-methylpyridin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2cc[n+](C)cc2-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C23H22N3O/c1-25(2)19-12-9-17(10-13-19)8-11-18-14-15-26(3)16-20(18)23-24-21-6-4-5-7-22(21)27-23/h4-16H,1-3H3/q+1 |
| InChIKey | BBDPRISLGJCVIG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 33.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|