C14H13N2O+ — CID 12597855
2-(1,4-dimethylpyridin-1-ium-3-yl)-1,3-benzoxazole (PubChem CID 12597855) has the molecular formula C14H13N2O+ and a molecular weight of 225.27 g/mol. Its IUPAC name is 2-(1,4-dimethylpyridin-1-ium-3-yl)-1,3-benzoxazole.
| Compound Name | 2-(1,4-dimethylpyridin-1-ium-3-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 12597855 |
| Molecular Formula | C14H13N2O+ |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-(1,4-dimethylpyridin-1-ium-3-yl)-1,3-benzoxazole |
| SMILES | Cc1cc[n+](C)cc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C14H13N2O/c1-10-7-8-16(2)9-11(10)14-15-12-5-3-4-6-13(12)17-14/h3-9H,1-2H3/q+1 |
| InChIKey | IXAJUKAJKIPDIJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|