C27H25N4+ — CID 12605843
4-[(E)-2-[6-(1H-benzimidazol-2-yl)-1-methylquinolin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 12605843) has the molecular formula C27H25N4+ and a molecular weight of 405.53 g/mol. Its IUPAC name is 4-[(E)-2-[6-(1H-benzimidazol-2-yl)-1-methylquinolin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[6-(1H-benzimidazol-2-yl)-1-methylquinolin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 12605843 |
| Molecular Formula | C27H25N4+ |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 4-[(E)-2-[6-(1H-benzimidazol-2-yl)-1-methylquinolin-1-ium-4-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2cc[n+](C)c3ccc(-c4nc5ccccc5[nH]4)cc23)cc1 |
| InChI | InChI=1S/C27H25N4/c1-30(2)22-13-9-19(10-14-22)8-11-20-16-17-31(3)26-15-12-21(18-23(20)26)27-28-24-6-4-5-7-25(24)29-27/h4-18H,1-3H3,(H,28,29)/q+1 |
| InChIKey | QAPDIAFZDJRPPU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 35.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|