C30H32N3+ — CID 54441377
4-[1-[4-(dimethylamino)phenyl]-4-(1-methylquinolin-1-ium-4-yl)buta-1,3-dienyl]-N,N-dimethylaniline (PubChem CID 54441377) has the molecular formula C30H32N3+ and a molecular weight of 434.61 g/mol. Its IUPAC name is 4-[1-[4-(dimethylamino)phenyl]-4-(1-methylquinolin-1-ium-4-yl)buta-1,3-dienyl]-N,N-dimethylaniline.
| Compound Name | 4-[1-[4-(dimethylamino)phenyl]-4-(1-methylquinolin-1-ium-4-yl)buta-1,3-dienyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 54441377 |
| Molecular Formula | C30H32N3+ |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 4-[1-[4-(dimethylamino)phenyl]-4-(1-methylquinolin-1-ium-4-yl)buta-1,3-dienyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(=CC=Cc2cc[n+](C)c3ccccc23)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H32N3/c1-31(2)26-17-13-24(14-18-26)28(25-15-19-27(20-16-25)32(3)4)11-8-9-23-21-22-33(5)30-12-7-6-10-29(23)30/h6-22H,1-5H3/q+1 |
| InChIKey | WOIJYUCKYROPNE-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|