C27H25N2+ — CID 20641135
(4Z)-1-methyl-4-[(2E,4E,6E)-7-(1-methylquinolin-1-ium-4-yl)hepta-2,4,6-trienylidene]quinoline (PubChem CID 20641135) has the molecular formula C27H25N2+ and a molecular weight of 377.51 g/mol. Its IUPAC name is (4Z)-1-methyl-4-[(2E,4E,6E)-7-(1-methylquinolin-1-ium-4-yl)hepta-2,4,6-trienylidene]quinoline.
| Compound Name | (4Z)-1-methyl-4-[(2E,4E,6E)-7-(1-methylquinolin-1-ium-4-yl)hepta-2,4,6-trienylidene]quinoline |
|---|---|
| PubChem CID | 20641135 |
| Molecular Formula | C27H25N2+ |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (4Z)-1-methyl-4-[(2E,4E,6E)-7-(1-methylquinolin-1-ium-4-yl)hepta-2,4,6-trienylidene]quinoline |
| SMILES | CN1C=C/C(=C/C=C/C=C/C=C/c2cc[n+](C)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C27H25N2/c1-28-20-18-22(24-14-8-10-16-26(24)28)12-6-4-3-5-7-13-23-19-21-29(2)27-17-11-9-15-25(23)27/h3-21H,1-2H3/q+1 |
| InChIKey | TWCQNHIIYHGJRH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|