C41H36F6N3P — CID 159192362
N-[2-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]-5-[2-(1-methylquinolin-4-ylidene)ethylidene]cyclopenten-1-yl]-N-phenylaniline hexafluorophosphate (PubChem CID 159192362) has the molecular formula C41H36F6N3P and a molecular weight of 715.72 g/mol. Its IUPAC name is N-[2-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]-5-[2-(1-methylquinolin-4-ylidene)ethylidene]cyclopenten-1-yl]-N-phenylaniline hexafluorophosphate.
| Compound Name | N-[2-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]-5-[2-(1-methylquinolin-4-ylidene)ethylidene]cyclopenten-1-yl]-N-phenylaniline hexafluorophosphate |
|---|---|
| PubChem CID | 159192362 |
| Molecular Formula | C41H36F6N3P |
| Molecular Weight | 715.72 g/mol |
| Exact Mass | 715.26 |
| IUPAC Name | N-[2-[2-(1-methylquinolin-1-ium-4-yl)ethenyl]-5-[2-(1-methylquinolin-4-ylidene)ethylidene]cyclopenten-1-yl]-N-phenylaniline hexafluorophosphate |
| SMILES | CN1C=CC(=CC=C2CCC(C=Cc3cc[n+](C)c4ccccc34)=C2N(c2ccccc2)c2ccccc2)c2ccccc21.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C41H36N3.F6P/c1-42-29-27-31(37-17-9-11-19-39(37)42)21-23-33-25-26-34(24-22-32-28-30-43(2)40-20-12-10-18-38(32)40)41(33)44(35-13-5-3-6-14-35)36-15-7-4-8-16-36;1-7(2,3,4,5)6/h3-24,27-30H,25-26H2,1-2H3;/q+1;-1 |
| InChIKey | OBRONUJVHCHGOP-UHFFFAOYSA-N |
| XLogP | 12.92 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.72 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|