C32H33ClN3+ — CID 173497507
4-[2-[2-chloro-3-[2-(1-ethylquinolin-1-ium-4-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-N-ethylquinolin-1-amine (PubChem CID 173497507) has the molecular formula C32H33ClN3+ and a molecular weight of 495.09 g/mol. Its IUPAC name is 4-[2-[2-chloro-3-[2-(1-ethylquinolin-1-ium-4-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-N-ethylquinolin-1-amine.
| Compound Name | 4-[2-[2-chloro-3-[2-(1-ethylquinolin-1-ium-4-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-N-ethylquinolin-1-amine |
|---|---|
| PubChem CID | 173497507 |
| Molecular Formula | C32H33ClN3+ |
| Molecular Weight | 495.09 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 4-[2-[2-chloro-3-[2-(1-ethylquinolin-1-ium-4-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-N-ethylquinolin-1-amine |
| SMILES | CCNN1C=CC(=CC=C2CCCC(C=Cc3cc[n+](CC)c4ccccc34)=C2Cl)c2ccccc21 |
| InChI | InChI=1S/C32H33ClN3/c1-3-34-36-23-21-25(29-13-6-8-15-31(29)36)17-19-27-11-9-10-26(32(27)33)18-16-24-20-22-35(4-2)30-14-7-5-12-28(24)30/h5-8,12-23,34H,3-4,9-11H2,1-2H3/q+1 |
| InChIKey | NBGDHBBRKYOVKS-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 19.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.09 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|