C30H32ClN2O3+ — CID 171517562
2-[(4Z)-4-[(2E,4E,6E)-7-[1-(2-hydroxyethyl)quinolin-1-ium-4-yl]hepta-2,4,6-trienylidene]quinolin-1-yl]ethanol;methyl hypochlorite (PubChem CID 171517562) has the molecular formula C30H32ClN2O3+ and a molecular weight of 504.05 g/mol. Its IUPAC name is 2-[(4Z)-4-[(2E,4E,6E)-7-[1-(2-hydroxyethyl)quinolin-1-ium-4-yl]hepta-2,4,6-trienylidene]quinolin-1-yl]ethanol;methyl hypochlorite.
| Compound Name | 2-[(4Z)-4-[(2E,4E,6E)-7-[1-(2-hydroxyethyl)quinolin-1-ium-4-yl]hepta-2,4,6-trienylidene]quinolin-1-yl]ethanol;methyl hypochlorite |
|---|---|
| PubChem CID | 171517562 |
| Molecular Formula | C30H32ClN2O3+ |
| Molecular Weight | 504.05 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 2-[(4Z)-4-[(2E,4E,6E)-7-[1-(2-hydroxyethyl)quinolin-1-ium-4-yl]hepta-2,4,6-trienylidene]quinolin-1-yl]ethanol;methyl hypochlorite |
| SMILES | COCl.OCCN1C=C/C(=C/C=C/C=C/C=C/c2cc[n+](CCO)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C29H29N2O2.CH3ClO/c32-22-20-30-18-16-24(26-12-6-8-14-28(26)30)10-4-2-1-3-5-11-25-17-19-31(21-23-33)29-15-9-7-13-27(25)29;1-3-2/h1-19,32-33H,20-23H2;1H3/q+1; |
| InChIKey | DHJTVDCQWAJSAM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 56.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.05 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|