C23H20N2O2 — CID 25211972
2-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-1,3-benzoxazol-6-ol (PubChem CID 25211972) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-1,3-benzoxazol-6-ol.
| Compound Name | 2-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-1,3-benzoxazol-6-ol |
|---|---|
| PubChem CID | 25211972 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[4-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]phenyl]-1,3-benzoxazol-6-ol |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(-c3nc4ccc(O)cc4o3)cc2)cc1 |
| InChI | InChI=1S/C23H20N2O2/c1-25(2)19-11-7-17(8-12-19)4-3-16-5-9-18(10-6-16)23-24-21-14-13-20(26)15-22(21)27-23/h3-15,26H,1-2H3/b4-3+ |
| InChIKey | MRVSBIUCJCOQKD-ONEGZZNKSA-N |
| XLogP | 5.44 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|