C23H16N2O6 — CID 23859806
4-[[2-[2-(1,3-benzoxazol-2-yl)benzoyl]oxyacetyl]amino]benzoic acid (PubChem CID 23859806) has the molecular formula C23H16N2O6 and a molecular weight of 416.39 g/mol. Its IUPAC name is 4-[[2-[2-(1,3-benzoxazol-2-yl)benzoyl]oxyacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[2-(1,3-benzoxazol-2-yl)benzoyl]oxyacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 23859806 |
| Molecular Formula | C23H16N2O6 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 4-[[2-[2-(1,3-benzoxazol-2-yl)benzoyl]oxyacetyl]amino]benzoic acid |
| SMILES | O=C(COC(=O)c1ccccc1-c1nc2ccccc2o1)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H16N2O6/c26-20(24-15-11-9-14(10-12-15)22(27)28)13-30-23(29)17-6-2-1-5-16(17)21-25-18-7-3-4-8-19(18)31-21/h1-12H,13H2,(H,24,26)(H,27,28) |
| InChIKey | BSGBDSSXTVCHTL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |