C23H19N3O6S — CID 25039802
[1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(1,3-benzoxazol-2-yl)benzoate (PubChem CID 25039802) has the molecular formula C23H19N3O6S and a molecular weight of 465.49 g/mol. Its IUPAC name is [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(1,3-benzoxazol-2-yl)benzoate.
| Compound Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(1,3-benzoxazol-2-yl)benzoate |
|---|---|
| PubChem CID | 25039802 |
| Molecular Formula | C23H19N3O6S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(1,3-benzoxazol-2-yl)benzoate |
| SMILES | CC(OC(=O)c1ccccc1-c1nc2ccccc2o1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C23H19N3O6S/c1-14(21(27)25-15-10-12-16(13-11-15)33(24,29)30)31-23(28)18-7-3-2-6-17(18)22-26-19-8-4-5-9-20(19)32-22/h2-14H,1H3,(H,25,27)(H2,24,29,30) |
| InChIKey | NHPMUGAIUHBDOZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |