C18H21N3O6S — CID 55308815
[1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(2-hydroxyethylamino)benzoate (PubChem CID 55308815) has the molecular formula C18H21N3O6S and a molecular weight of 407.45 g/mol. Its IUPAC name is [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(2-hydroxyethylamino)benzoate.
| Compound Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(2-hydroxyethylamino)benzoate |
|---|---|
| PubChem CID | 55308815 |
| Molecular Formula | C18H21N3O6S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-(2-hydroxyethylamino)benzoate |
| SMILES | CC(OC(=O)c1ccccc1NCCO)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H21N3O6S/c1-12(17(23)21-13-6-8-14(9-7-13)28(19,25)26)27-18(24)15-4-2-3-5-16(15)20-10-11-22/h2-9,12,20,22H,10-11H2,1H3,(H,21,23)(H2,19,25,26) |
| InChIKey | NHVPNGMWZGKKAO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |