C16H15Cl2N3O5S — CID 2637600
[(2S)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-amino-3,5-dichlorobenzoate (PubChem CID 2637600) has the molecular formula C16H15Cl2N3O5S and a molecular weight of 432.29 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [(2S)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2637600 |
| Molecular Formula | C16H15Cl2N3O5S |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | [(2S)-1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 2-amino-3,5-dichlorobenzoate |
| SMILES | C[C@H](OC(=O)c1cc(Cl)cc(Cl)c1N)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H15Cl2N3O5S/c1-8(26-16(23)12-6-9(17)7-13(18)14(12)19)15(22)21-10-2-4-11(5-3-10)27(20,24)25/h2-8H,19H2,1H3,(H,21,22)(H2,20,24,25)/t8-/m0/s1 |
| InChIKey | KFBBPFPLUVVMNI-QMMMGPOBSA-N |
| XLogP | 2.41 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|