C18H18Cl2N2O3 — CID 7864673
[(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl] 2-amino-3,5-dichlorobenzoate (PubChem CID 7864673) has the molecular formula C18H18Cl2N2O3 and a molecular weight of 381.26 g/mol. Its IUPAC name is [(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 7864673 |
| Molecular Formula | C18H18Cl2N2O3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | [(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl] 2-amino-3,5-dichlorobenzoate |
| SMILES | CCc1ccc(NC(=O)[C@@H](C)OC(=O)c2cc(Cl)cc(Cl)c2N)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O3/c1-3-11-4-6-13(7-5-11)22-17(23)10(2)25-18(24)14-8-12(19)9-15(20)16(14)21/h4-10H,3,21H2,1-2H3,(H,22,23)/t10-/m1/s1 |
| InChIKey | XMIOQOSECATFPY-SNVBAGLBSA-N |
| XLogP | 4.32 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|