C17H14ClN3O5S — CID 25489441
[(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 25489441) has the molecular formula C17H14ClN3O5S and a molecular weight of 407.84 g/mol. Its IUPAC name is [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 25489441 |
| Molecular Formula | C17H14ClN3O5S |
| Molecular Weight | 407.84 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | [(2S)-1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | C[C@H](OC(=O)c1cc(S(N)(=O)=O)ccc1Cl)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C17H14ClN3O5S/c1-10(16(22)21-12-4-2-3-11(7-12)9-19)26-17(23)14-8-13(27(20,24)25)5-6-15(14)18/h2-8,10H,1H3,(H,21,22)(H2,20,24,25)/t10-/m0/s1 |
| InChIKey | BOIFKWPYEXQERN-JTQLQIEISA-N |
| XLogP | 2.04 |
| TPSA | 139.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.84 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |