C22H14ClNO4 — CID 23831669
[2-(4-chlorophenyl)-2-oxoethyl] 2-(1,3-benzoxazol-2-yl)benzoate (PubChem CID 23831669) has the molecular formula C22H14ClNO4 and a molecular weight of 391.81 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 2-(1,3-benzoxazol-2-yl)benzoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-(1,3-benzoxazol-2-yl)benzoate |
|---|---|
| PubChem CID | 23831669 |
| Molecular Formula | C22H14ClNO4 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 2-(1,3-benzoxazol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1-c1nc2ccccc2o1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H14ClNO4/c23-15-11-9-14(10-12-15)19(25)13-27-22(26)17-6-2-1-5-16(17)21-24-18-7-3-4-8-20(18)28-21/h1-12H,13H2 |
| InChIKey | XEOZNPVGQCDRGH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |