About [2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate
[2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate (PubChem CID 23860088) has the molecular formula C27H19NO5
and a molecular weight of 437.45 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate.
Molecular Properties
| Compound Name | [2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate |
| PubChem CID | 23860088 |
| Molecular Formula | C27H19NO5 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | [2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate |
| SMILES | COc1ccccc1C(=O)COC(=O)c1cccc2cccc(-c3nc4ccccc4o3)c12 |
| InChI | InChI=1S/C27H19NO5/c1-31-23-14-4-2-10-18(23)22(29)16-32-27(30)20-12-7-9-17-8-6-11-19(25(17)20)26-28-21-13-3-5-15-24(21)33-26/h2-15H,16H2,1H3 |
| InChIKey | AWFPEXHGKBEAII-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate?
The IUPAC name of [2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate (CID 23860088) is [2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate.
What is the SMILES notation for [2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate?
The canonical SMILES for [2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate is COc1ccccc1C(=O)COC(=O)c1cccc2cccc(-c3nc4ccccc4o3)c12.
What is the InChIKey of [2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate?
The InChIKey is AWFPEXHGKBEAII-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19NO5/c1-31-23-14-4-2-10-18(23)22(29)16-32-27(30)20-12-7-9-17-8-6-11-19(25(17)20)26-28-21-13-3-5-15-24(21)33-26/h2-15H,16H2,1H3.
What are the key properties of [2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate?
[2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate has a molecular weight of 437.45 g/mol, XLogP of 5.70, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methoxyphenyl)-2-oxoethyl] 8-(1,3-benzoxazol-2-yl)naphthalene-1-carboxylate is sourced from PubChem (CID 23860088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).