C17H29NO2Si — CID 11822969
tert-butyl-dimethyl-[[(1R,8R,13R)-2-oxa-3-azatricyclo[6.4.1.04,13]trideca-3,11-dien-9-yl]oxy]silane (PubChem CID 11822969) has the molecular formula C17H29NO2Si and a molecular weight of 307.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,8R,13R)-2-oxa-3-azatricyclo[6.4.1.04,13]trideca-3,11-dien-9-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,8R,13R)-2-oxa-3-azatricyclo[6.4.1.04,13]trideca-3,11-dien-9-yl]oxy]silane |
|---|---|
| PubChem CID | 11822969 |
| Molecular Formula | C17H29NO2Si |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,8R,13R)-2-oxa-3-azatricyclo[6.4.1.04,13]trideca-3,11-dien-9-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC=C[C@H]2ON=C3CCC[C@@H]1[C@H]32 |
| InChI | InChI=1S/C17H29NO2Si/c1-17(2,3)21(4,5)20-14-10-7-11-15-16-12(14)8-6-9-13(16)18-19-15/h7,11-12,14-16H,6,8-10H2,1-5H3/t12-,14?,15+,16+/m0/s1 |
| InChIKey | OPKSOCVOPJMZAQ-FHNKSYRXSA-N |
| XLogP | 4.51 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|