C19H34OSi — CID 102115647
[(2S,3aS,4R,7aS)-2-[(E)-but-1-enyl]-2,3,3a,4,5,7a-hexahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102115647) has the molecular formula C19H34OSi and a molecular weight of 306.57 g/mol. Its IUPAC name is [(2S,3aS,4R,7aS)-2-[(E)-but-1-enyl]-2,3,3a,4,5,7a-hexahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3aS,4R,7aS)-2-[(E)-but-1-enyl]-2,3,3a,4,5,7a-hexahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102115647 |
| Molecular Formula | C19H34OSi |
| Molecular Weight | 306.57 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | [(2S,3aS,4R,7aS)-2-[(E)-but-1-enyl]-2,3,3a,4,5,7a-hexahydro-1H-inden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC/C=C/[C@@H]1C[C@H]2[C@H](C=CC[C@H]2O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C19H34OSi/c1-7-8-10-15-13-16-11-9-12-18(17(16)14-15)20-21(5,6)19(2,3)4/h8-11,15-18H,7,12-14H2,1-6H3/b10-8+/t15-,16+,17-,18+/m0/s1 |
| InChIKey | IEZWJDIJAFFNBH-AQPXNMCESA-N |
| XLogP | 5.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|