C24H48O5Si2 — CID 15605711
2-[(2S,3R,4aR,6S,7R,8aR)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]acetaldehyde (PubChem CID 15605711) has the molecular formula C24H48O5Si2 and a molecular weight of 472.82 g/mol. Its IUPAC name is 2-[(2S,3R,4aR,6S,7R,8aR)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3R,4aR,6S,7R,8aR)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 15605711 |
| Molecular Formula | C24H48O5Si2 |
| Molecular Weight | 472.82 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 2-[(2S,3R,4aR,6S,7R,8aR)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-ethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]acetaldehyde |
| SMILES | CC[C@@H]1O[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CC=O)O[C@@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O5Si2/c1-12-17-21(28-30(8,9)23(2,3)4)15-20-19(26-17)16-22(18(27-20)13-14-25)29-31(10,11)24(5,6)7/h14,17-22H,12-13,15-16H2,1-11H3/t17-,18-,19+,20+,21+,22+/m0/s1 |
| InChIKey | CWQUPQBHWMATMN-IUVRRTPNSA-N |
| XLogP | 6.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.82 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|