C16H28N2O4Si — CID 174085318
1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-2-yl]-4-methylpyrimidin-2-one (PubChem CID 174085318) has the molecular formula C16H28N2O4Si and a molecular weight of 340.50 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-2-yl]-4-methylpyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-2-yl]-4-methylpyrimidin-2-one |
|---|---|
| PubChem CID | 174085318 |
| Molecular Formula | C16H28N2O4Si |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(hydroxymethyl)oxolan-2-yl]-4-methylpyrimidin-2-one |
| SMILES | Cc1ccn([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O2)c(=O)n1 |
| InChI | InChI=1S/C16H28N2O4Si/c1-11-7-8-18(15(20)17-11)14-9-12(13(10-19)21-14)22-23(5,6)16(2,3)4/h7-8,12-14,19H,9-10H2,1-6H3/t12-,13+,14+/m0/s1 |
| InChIKey | INAFAKCSMHVZMB-BFHYXJOUSA-N |
| XLogP | 2.22 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|