C20H29NO2Si — CID 101353411
(7S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-8-phenyl-1-azabicyclo[5.2.0]non-3-en-9-one (PubChem CID 101353411) has the molecular formula C20H29NO2Si and a molecular weight of 343.54 g/mol. Its IUPAC name is (7S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-8-phenyl-1-azabicyclo[5.2.0]non-3-en-9-one.
| Compound Name | (7S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-8-phenyl-1-azabicyclo[5.2.0]non-3-en-9-one |
|---|---|
| PubChem CID | 101353411 |
| Molecular Formula | C20H29NO2Si |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | (7S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-8-phenyl-1-azabicyclo[5.2.0]non-3-en-9-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC=CCN2C(=O)[C@H](c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C20H29NO2Si/c1-20(2,3)24(4,5)23-16-13-9-10-14-21-18(16)17(19(21)22)15-11-7-6-8-12-15/h6-12,16-18H,13-14H2,1-5H3/t16?,17-,18-/m1/s1 |
| InChIKey | VWRHKVMTCGLLHY-UKKPGEIXSA-N |
| XLogP | 4.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|