C14H15NO2 — CID 101353409
(7S,8R)-6-hydroxy-8-phenyl-1-azabicyclo[5.2.0]non-3-en-9-one (PubChem CID 101353409) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is (7S,8R)-6-hydroxy-8-phenyl-1-azabicyclo[5.2.0]non-3-en-9-one.
| Compound Name | (7S,8R)-6-hydroxy-8-phenyl-1-azabicyclo[5.2.0]non-3-en-9-one |
|---|---|
| PubChem CID | 101353409 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (7S,8R)-6-hydroxy-8-phenyl-1-azabicyclo[5.2.0]non-3-en-9-one |
| SMILES | O=C1[C@H](c2ccccc2)[C@H]2C(O)CC=CCN12 |
| InChI | InChI=1S/C14H15NO2/c16-11-8-4-5-9-15-13(11)12(14(15)17)10-6-2-1-3-7-10/h1-7,11-13,16H,8-9H2/t11?,12-,13-/m1/s1 |
| InChIKey | YQTQRVLSEHUTGI-VFRRUGBOSA-N |
| XLogP | 1.30 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|