C21H23NO — CID 102205609
(3R,4S)-4-cyclohexyl-1,3-diphenylazetidin-2-one (PubChem CID 102205609) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is (3R,4S)-4-cyclohexyl-1,3-diphenylazetidin-2-one.
| Compound Name | (3R,4S)-4-cyclohexyl-1,3-diphenylazetidin-2-one |
|---|---|
| PubChem CID | 102205609 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (3R,4S)-4-cyclohexyl-1,3-diphenylazetidin-2-one |
| SMILES | O=C1[C@H](c2ccccc2)[C@H](C2CCCCC2)N1c1ccccc1 |
| InChI | InChI=1S/C21H23NO/c23-21-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)22(21)18-14-8-3-9-15-18/h1,3-5,8-11,14-15,17,19-20H,2,6-7,12-13H2/t19-,20+/m1/s1 |
| InChIKey | HGWMJOLRCNBBHW-UXHICEINSA-N |
| XLogP | 4.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |