C28H28N2O2 — CID 131845183
(2S,5S)-5-benzoyl-1-cyclohexyl-2,3-diphenylimidazolidin-4-one (PubChem CID 131845183) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is (2S,5S)-5-benzoyl-1-cyclohexyl-2,3-diphenylimidazolidin-4-one.
| Compound Name | (2S,5S)-5-benzoyl-1-cyclohexyl-2,3-diphenylimidazolidin-4-one |
|---|---|
| PubChem CID | 131845183 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (2S,5S)-5-benzoyl-1-cyclohexyl-2,3-diphenylimidazolidin-4-one |
| SMILES | O=C(c1ccccc1)[C@H]1C(=O)N(c2ccccc2)[C@@H](c2ccccc2)N1C1CCCCC1 |
| InChI | InChI=1S/C28H28N2O2/c31-26(21-13-5-1-6-14-21)25-28(32)30(24-19-11-4-12-20-24)27(22-15-7-2-8-16-22)29(25)23-17-9-3-10-18-23/h1-2,4-8,11-16,19-20,23,25,27H,3,9-10,17-18H2/t25-,27-/m0/s1 |
| InChIKey | GZVBFOOUEUGVJY-BDYUSTAISA-N |
| XLogP | 5.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|