C18H24N2O3S — CID 51491662
(4aR,7aR)-1-cyclohexyl-6,6-dioxo-4-phenyl-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one (PubChem CID 51491662) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is (4aR,7aR)-1-cyclohexyl-6,6-dioxo-4-phenyl-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aR,7aR)-1-cyclohexyl-6,6-dioxo-4-phenyl-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 51491662 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (4aR,7aR)-1-cyclohexyl-6,6-dioxo-4-phenyl-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
| SMILES | O=C1CN(C2CCCCC2)[C@H]2CS(=O)(=O)C[C@@H]2N1c1ccccc1 |
| InChI | InChI=1S/C18H24N2O3S/c21-18-11-19(14-7-3-1-4-8-14)16-12-24(22,23)13-17(16)20(18)15-9-5-2-6-10-15/h2,5-6,9-10,14,16-17H,1,3-4,7-8,11-13H2/t16-,17-/m0/s1 |
| InChIKey | RGXZDZTXWBDTMP-IRXDYDNUSA-N |
| XLogP | 1.83 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |