C21H24N2O3S — CID 38997500
(4aS,7aR)-4-(4-methylphenyl)-6,6-dioxo-1-[(1R)-1-phenylethyl]-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one (PubChem CID 38997500) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is (4aS,7aR)-4-(4-methylphenyl)-6,6-dioxo-1-[(1R)-1-phenylethyl]-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aS,7aR)-4-(4-methylphenyl)-6,6-dioxo-1-[(1R)-1-phenylethyl]-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 38997500 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (4aS,7aR)-4-(4-methylphenyl)-6,6-dioxo-1-[(1R)-1-phenylethyl]-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
| SMILES | Cc1ccc(N2C(=O)CN([C@H](C)c3ccccc3)[C@H]3CS(=O)(=O)C[C@H]32)cc1 |
| InChI | InChI=1S/C21H24N2O3S/c1-15-8-10-18(11-9-15)23-20-14-27(25,26)13-19(20)22(12-21(23)24)16(2)17-6-4-3-5-7-17/h3-11,16,19-20H,12-14H2,1-2H3/t16-,19+,20-/m1/s1 |
| InChIKey | JPLVILVLGGSVFR-LSTHTHJFSA-N |
| XLogP | 2.57 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |