C20H21ClN2O3S — CID 50752014
(4aS,7aR)-4-(4-chlorophenyl)-6,6-dioxo-1-(1-phenylethyl)-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one (PubChem CID 50752014) has the molecular formula C20H21ClN2O3S and a molecular weight of 404.92 g/mol. Its IUPAC name is (4aS,7aR)-4-(4-chlorophenyl)-6,6-dioxo-1-(1-phenylethyl)-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aS,7aR)-4-(4-chlorophenyl)-6,6-dioxo-1-(1-phenylethyl)-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 50752014 |
| Molecular Formula | C20H21ClN2O3S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (4aS,7aR)-4-(4-chlorophenyl)-6,6-dioxo-1-(1-phenylethyl)-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
| SMILES | CC(c1ccccc1)N1CC(=O)N(c2ccc(Cl)cc2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C20H21ClN2O3S/c1-14(15-5-3-2-4-6-15)22-11-20(24)23(17-9-7-16(21)8-10-17)19-13-27(25,26)12-18(19)22/h2-10,14,18-19H,11-13H2,1H3/t14?,18-,19+/m0/s1 |
| InChIKey | GKAKLYQOECCTCW-GGUZCGDUSA-N |
| XLogP | 2.92 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |