C22H26N2O3S — CID 50751884
(4aS,7aR)-4-(3,4-dimethylphenyl)-6,6-dioxo-1-(1-phenylethyl)-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one (PubChem CID 50751884) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is (4aS,7aR)-4-(3,4-dimethylphenyl)-6,6-dioxo-1-(1-phenylethyl)-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aS,7aR)-4-(3,4-dimethylphenyl)-6,6-dioxo-1-(1-phenylethyl)-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 50751884 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (4aS,7aR)-4-(3,4-dimethylphenyl)-6,6-dioxo-1-(1-phenylethyl)-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
| SMILES | Cc1ccc(N2C(=O)CN(C(C)c3ccccc3)[C@H]3CS(=O)(=O)C[C@H]32)cc1C |
| InChI | InChI=1S/C22H26N2O3S/c1-15-9-10-19(11-16(15)2)24-21-14-28(26,27)13-20(21)23(12-22(24)25)17(3)18-7-5-4-6-8-18/h4-11,17,20-21H,12-14H2,1-3H3/t17?,20-,21+/m0/s1 |
| InChIKey | YIFITLNYFZQEDG-GLTUQPQBSA-N |
| XLogP | 2.88 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |