C21H23ClN2O4S — CID 100887823
(4aR,7aS)-4-(4-chlorophenyl)-1-[2-(2-methoxyphenyl)ethyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one (PubChem CID 100887823) has the molecular formula C21H23ClN2O4S and a molecular weight of 434.95 g/mol. Its IUPAC name is (4aR,7aS)-4-(4-chlorophenyl)-1-[2-(2-methoxyphenyl)ethyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aR,7aS)-4-(4-chlorophenyl)-1-[2-(2-methoxyphenyl)ethyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 100887823 |
| Molecular Formula | C21H23ClN2O4S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | (4aR,7aS)-4-(4-chlorophenyl)-1-[2-(2-methoxyphenyl)ethyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
| SMILES | COc1ccccc1CCN1CC(=O)N(c2ccc(Cl)cc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C21H23ClN2O4S/c1-28-20-5-3-2-4-15(20)10-11-23-12-21(25)24(17-8-6-16(22)7-9-17)19-14-29(26,27)13-18(19)23/h2-9,18-19H,10-14H2,1H3/t18-,19+/m1/s1 |
| InChIKey | NRAVIPCMUUVSPL-MOPGFXCFSA-N |
| XLogP | 2.41 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |