C24H30N2O5S — CID 38997527
(4aS,7aR)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-(3,5-dimethylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one (PubChem CID 38997527) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is (4aS,7aR)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-(3,5-dimethylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aS,7aR)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-(3,5-dimethylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 38997527 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | (4aS,7aR)-1-[2-(3,4-dimethoxyphenyl)ethyl]-4-(3,5-dimethylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
| SMILES | COc1ccc(CCN2CC(=O)N(c3cc(C)cc(C)c3)[C@@H]3CS(=O)(=O)C[C@@H]32)cc1OC |
| InChI | InChI=1S/C24H30N2O5S/c1-16-9-17(2)11-19(10-16)26-21-15-32(28,29)14-20(21)25(13-24(26)27)8-7-18-5-6-22(30-3)23(12-18)31-4/h5-6,9-12,20-21H,7-8,13-15H2,1-4H3/t20-,21+/m0/s1 |
| InChIKey | VRBSLLWMLZVHLS-LEWJYISDSA-N |
| XLogP | 2.38 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |