C21H23FN2O3S — CID 75543459
4-(3,5-dimethylphenyl)-1-[(4-fluorophenyl)methyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one (PubChem CID 75543459) has the molecular formula C21H23FN2O3S and a molecular weight of 402.49 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-1-[(4-fluorophenyl)methyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one.
| Compound Name | 4-(3,5-dimethylphenyl)-1-[(4-fluorophenyl)methyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 75543459 |
| Molecular Formula | C21H23FN2O3S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-1-[(4-fluorophenyl)methyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
| SMILES | Cc1cc(C)cc(N2C(=O)CN(Cc3ccc(F)cc3)C3CS(=O)(=O)CC32)c1 |
| InChI | InChI=1S/C21H23FN2O3S/c1-14-7-15(2)9-18(8-14)24-20-13-28(26,27)12-19(20)23(11-21(24)25)10-16-3-5-17(22)6-4-16/h3-9,19-20H,10-13H2,1-2H3 |
| InChIKey | DUVGAIMQJIAUHQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |