C21H27ClN2O4S — CID 42345003
(4aS,7aS)-4-(3-chloro-4-methoxyphenyl)-1-[2-(cyclohexen-1-yl)ethyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one (PubChem CID 42345003) has the molecular formula C21H27ClN2O4S and a molecular weight of 438.98 g/mol. Its IUPAC name is (4aS,7aS)-4-(3-chloro-4-methoxyphenyl)-1-[2-(cyclohexen-1-yl)ethyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aS,7aS)-4-(3-chloro-4-methoxyphenyl)-1-[2-(cyclohexen-1-yl)ethyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 42345003 |
| Molecular Formula | C21H27ClN2O4S |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (4aS,7aS)-4-(3-chloro-4-methoxyphenyl)-1-[2-(cyclohexen-1-yl)ethyl]-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
| SMILES | COc1ccc(N2C(=O)CN(CCC3=CCCCC3)[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl |
| InChI | InChI=1S/C21H27ClN2O4S/c1-28-20-8-7-16(11-17(20)22)24-19-14-29(26,27)13-18(19)23(12-21(24)25)10-9-15-5-3-2-4-6-15/h5,7-8,11,18-19H,2-4,6,9-10,12-14H2,1H3/t18-,19-/m1/s1 |
| InChIKey | KRNPQIKNBDLUNV-RTBURBONSA-N |
| XLogP | 3.05 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|