C18H19ClN2O5S — CID 42345018
(4aR,7aR)-4-(3-chloro-4-methoxyphenyl)-1-(furan-2-ylmethyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one (PubChem CID 42345018) has the molecular formula C18H19ClN2O5S and a molecular weight of 410.88 g/mol. Its IUPAC name is (4aR,7aR)-4-(3-chloro-4-methoxyphenyl)-1-(furan-2-ylmethyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aR,7aR)-4-(3-chloro-4-methoxyphenyl)-1-(furan-2-ylmethyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 42345018 |
| Molecular Formula | C18H19ClN2O5S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | (4aR,7aR)-4-(3-chloro-4-methoxyphenyl)-1-(furan-2-ylmethyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
| SMILES | COc1ccc(N2C(=O)CN(Cc3ccco3)[C@H]3CS(=O)(=O)C[C@@H]32)cc1Cl |
| InChI | InChI=1S/C18H19ClN2O5S/c1-25-17-5-4-12(7-14(17)19)21-16-11-27(23,24)10-15(16)20(9-18(21)22)8-13-3-2-6-26-13/h2-7,15-16H,8-11H2,1H3/t15-,16-/m0/s1 |
| InChIKey | HKOZDFHLZRTEFC-HOTGVXAUSA-N |
| XLogP | 1.96 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |