C23H28N2O5S — CID 50751727
(4aS,7aR)-1-[2-(2,5-dimethoxyphenyl)ethyl]-4-(3-methylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one (PubChem CID 50751727) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is (4aS,7aR)-1-[2-(2,5-dimethoxyphenyl)ethyl]-4-(3-methylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one.
| Compound Name | (4aS,7aR)-1-[2-(2,5-dimethoxyphenyl)ethyl]-4-(3-methylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 50751727 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (4aS,7aR)-1-[2-(2,5-dimethoxyphenyl)ethyl]-4-(3-methylphenyl)-6,6-dioxo-4a,5,7,7a-tetrahydro-2H-thieno[3,4-b]pyrazin-3-one |
| SMILES | COc1ccc(OC)c(CCN2CC(=O)N(c3cccc(C)c3)[C@@H]3CS(=O)(=O)C[C@@H]32)c1 |
| InChI | InChI=1S/C23H28N2O5S/c1-16-5-4-6-18(11-16)25-21-15-31(27,28)14-20(21)24(13-23(25)26)10-9-17-12-19(29-2)7-8-22(17)30-3/h4-8,11-12,20-21H,9-10,13-15H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | SOEDQITZAAGEPL-LEWJYISDSA-N |
| XLogP | 2.07 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |