C25H19NO — CID 102273655
(3S,4S)-4-naphthalen-1-yl-1,3-diphenylazetidin-2-one (PubChem CID 102273655) has the molecular formula C25H19NO and a molecular weight of 349.43 g/mol. Its IUPAC name is (3S,4S)-4-naphthalen-1-yl-1,3-diphenylazetidin-2-one.
| Compound Name | (3S,4S)-4-naphthalen-1-yl-1,3-diphenylazetidin-2-one |
|---|---|
| PubChem CID | 102273655 |
| Molecular Formula | C25H19NO |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (3S,4S)-4-naphthalen-1-yl-1,3-diphenylazetidin-2-one |
| SMILES | O=C1[C@@H](c2ccccc2)[C@@H](c2cccc3ccccc23)N1c1ccccc1 |
| InChI | InChI=1S/C25H19NO/c27-25-23(19-11-3-1-4-12-19)24(26(25)20-14-5-2-6-15-20)22-17-9-13-18-10-7-8-16-21(18)22/h1-17,23-24H/t23-,24+/m0/s1 |
| InChIKey | WEOWGCABXGLQNM-BJKOFHAPSA-N |
| XLogP | 5.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |