C11H10O2 — CID 170551049
(4S,5R)-4-hydroxy-5-phenylcyclopent-2-en-1-one (PubChem CID 170551049) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is (4S,5R)-4-hydroxy-5-phenylcyclopent-2-en-1-one.
| Compound Name | (4S,5R)-4-hydroxy-5-phenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 170551049 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (4S,5R)-4-hydroxy-5-phenylcyclopent-2-en-1-one |
| SMILES | O=C1C=C[C@H](O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H10O2/c12-9-6-7-10(13)11(9)8-4-2-1-3-5-8/h1-7,9,11-12H/t9-,11+/m0/s1 |
| InChIKey | XTMOUGOROVDTGR-GXSJLCMTSA-N |
| XLogP | 1.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |