C20H18O — CID 10978676
(1R,2R,4S,5S)-2,4-diphenylbicyclo[3.2.1]oct-6-en-3-one (PubChem CID 10978676) has the molecular formula C20H18O and a molecular weight of 274.36 g/mol. Its IUPAC name is (1R,2R,4S,5S)-2,4-diphenylbicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2R,4S,5S)-2,4-diphenylbicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 10978676 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (1R,2R,4S,5S)-2,4-diphenylbicyclo[3.2.1]oct-6-en-3-one |
| SMILES | O=C1[C@H](c2ccccc2)[C@@H]2C=C[C@@H](C2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H18O/c21-20-18(14-7-3-1-4-8-14)16-11-12-17(13-16)19(20)15-9-5-2-6-10-15/h1-12,16-19H,13H2/t16-,17+,18-,19+ |
| InChIKey | UTGZUWWUUHDRNH-QGFMHUBQSA-N |
| XLogP | 4.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|