C15H13F3O — CID 101128587
2,2,2-trifluoro-1-[(1R,2S,3S,4S)-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]ethanone (PubChem CID 101128587) has the molecular formula C15H13F3O and a molecular weight of 266.26 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(1R,2S,3S,4S)-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[(1R,2S,3S,4S)-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]ethanone |
|---|---|
| PubChem CID | 101128587 |
| Molecular Formula | C15H13F3O |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2,2,2-trifluoro-1-[(1R,2S,3S,4S)-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]ethanone |
| SMILES | O=C([C@@H]1[C@@H](c2ccccc2)[C@@H]2C=C[C@H]1C2)C(F)(F)F |
| InChI | InChI=1S/C15H13F3O/c16-15(17,18)14(19)13-11-7-6-10(8-11)12(13)9-4-2-1-3-5-9/h1-7,10-13H,8H2/t10-,11+,12+,13+/m1/s1 |
| InChIKey | FSOLKNDARWNRJB-VOAKCMCISA-N |
| XLogP | 3.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|